Systematic / IUPAC Name: 2-[(3S)-1-(Cyclopropylmethyl)pyrrolidin-3-yl]-1-methylbenzimidazole
ID: Reference11170
Other Names: NAT31-470439
Formula: C16H21N3
2-[(3S)-1-(Cyclopropylmethyl)-3-pyrrolidinyl]-1-methyl-1H-benzimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 914 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/28/2022 8:48:05 AM |
| InChI | InChI=1S/C16H21N3/c1-18-15-5-3-2-4-14(15)17-16(18)13-8-9-19(11-13)10-12-6-7-12/h2-5,12-13H,6-11H2,1H3/t13-/m0/s1 |
| InChI Key | RAOIFFGLVCVSRJ-ZDUSSCGKSA-N |
| Canonical SMILES | CN1C2=CC=CC=C2N=C1C3CCN(C3)CC4CC4 |
| CAS | |
| Splash | |
| Other Names | NAT31-470439 |