Systematic / IUPAC Name: 2-[(3S)-1-Cyclobutylpyrrolidin-3-yl]-1,3-benzothiazole
ID: Reference11185
Other Names: NAT31-456965
Formula: C15H18N2S
2-[(3S)-1-Cyclobutyl-3-pyrrolidinyl]-1,3-benzothiazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1135 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/4/2022 10:07:34 AM |
| InChI | InChI=1S/C15H18N2S/c1-2-7-14-13(6-1)16-15(18-14)11-8-9-17(10-11)12-4-3-5-12/h1-2,6-7,11-12H,3-5,8-10H2/t11-/m0/s1 |
| InChI Key | YPXJPEMHTLLPIE-NSHDSACASA-N |
| Canonical SMILES | C1CC(C1)N2CCC(C2)C3=NC4=CC=CC=C4S3 |
| CAS | |
| Splash | |
| Other Names | NAT31-456965 |