Systematic / IUPAC Name: (4R,7S,8aS)-4-[3-(4-Hydroxypiperidin-1-yl)-3-oxopropyl]-7-[(4-methoxyphenyl)methylamino]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one
ID: Reference11192
Other Names: NAT23-380637
Formula: C23H34N4O4
(4R,7S,8aS)-4-[3-(4-Hydroxy-1-piperidinyl)-3-oxopropyl]-7-[(4-methoxybenzyl)amino]hexahydropyrrolo[1,2-a]pyrazin-1(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2109 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/4/2022 10:22:27 AM |
| InChI | InChI=1S/C23H34N4O4/c1-31-20-5-2-16(3-6-20)13-24-17-12-21-23(30)25-14-18(27(21)15-17)4-7-22(29)26-10-8-19(28)9-11-26/h2-3,5-6,17-19,21,24,28H,4,7-15H2,1H3,(H,25,30)/t17-,18+,21-/m0/s1 |
| InChI Key | ILCXZVGMXFUIJT-UEXGIBASSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)CNC2CC3C(=O)NCC(N3C2)CCC(=O)N4CCC(CC4)O |
| CAS | |
| Splash | |
| Other Names | NAT23-380637 |