Systematic / IUPAC Name: (E)-1-(4-Hydroxyphenyl)-3-(1H-indol-3-yl)prop-2-en-1-one
ID: Reference11197
Other Names: 03_H-CH12
Formula: C17H13NO2
(2E)-1-(4-Hydroxyphenyl)-3-(1H-indol-3-yl)-2-propen-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 579 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/7/2022 12:01:02 PM |
| InChI | InChI=1S/C17H13NO2/c19-14-8-5-12(6-9-14)17(20)10-7-13-11-18-16-4-2-1-3-15(13)16/h1-11,18-19H/b10-7+ |
| InChI Key | DUFRKBZXGNZLSV-JXMROGBWSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(=CN2)C=CC(=O)C3=CC=C(C=C3)O |
| CAS | |
| Splash | |
| Other Names | 03_H-CH12 |
| ChemSpider | 8882014 |
| ChEMBL | CHEMBL1172343 |
| PubChem | 10706673 |