Systematic / IUPAC Name: (E)-1-(4-Hydroxyphenyl)-3-(1-methylindol-3-yl)prop-2-en-1-one
ID: Reference11198
Other Names: 04_Me-CH12
Formula: C18H15NO2
(2E)-1-(4-Hydroxyphenyl)-3-(1-methyl-1H-indol-3-yl)-2-propen-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 620 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/7/2022 12:03:26 PM |
| InChI | InChI=1S/C18H15NO2/c1-19-12-14(16-4-2-3-5-17(16)19)8-11-18(21)13-6-9-15(20)10-7-13/h2-12,20H,1H3/b11-8+ |
| InChI Key | BKXODHXPUBTFLR-DHZHZOJOSA-N |
| Canonical SMILES | CN1C=C(C2=CC=CC=C21)C=CC(=O)C3=CC=C(C=C3)O |
| CAS | |
| Splash | |
| Other Names | 04_Me-CH12 |
| ChEMBL | CHEMBL1170297 |
| ChemSpider | 25048555 |
| PubChem | 49798333 |