Systematic / IUPAC Name: (3R,5S,6E)-7-{4-(4-Fluorophenyl)-6-isopropyl-2-[methyl(methylsulfonyl)amino]-5-pyrimidinyl}-3,5-dihydroxy-6-heptenoic acid
ID: Reference1122
Other Names:
(3R,5S,6E)-7-{4-(4-Fluorophenyl)-6-(1-methylethyl)-2-[ethyl(methylsulfonyl)amino]-5-pyrimidinyl}-3,5-dihydroxy-6-heptenoic acid ;
(3R,5S,6E)-7-{4-(4-Fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-(propan-2-yl)pyrimidin-5-yl}-3,5-dihydroxyhept-6-enoic acid
Formula: C22H28FN3O6S
Class: Therapeutics/Prescription Drugs Endogenous Metabolites
Rosuvastatin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap Elite |
| No. of Spectral Trees | 3 |
| No. of Spectra | 6752 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 3/30/2017 12:14:28 PM |
| InChI | InChI=1S/C22H28FN3O6S/c1-13(2)20-18(10-9-16(27)11-17(28)12-19(29)30)21(14-5-7-15(23)8-6-14)25-22(24-20)26(3)33(4,31)32/h5-10,13,16-17,27-28H,11-12H2,1-4H3,(H,29,30)/b10-9+/t16-,17-/m1/s1 |
| InChI Key | BPRHUIZQVSMCRT-VEUZHWNKSA-N |
| Canonical SMILES | CC(C)C1=NC(=NC(=C1/C=C/C(CC(CC(=O)O)O)O)C2=CC=C(C=C2)F)N(C)S(=O)(=O)C |
| CAS | 287714414 |
| Splash | |
| Other Names |
(3R,5S,6E)-7-{4-(4-Fluorophenyl)-6-(1-methylethyl)-2-[ethyl(methylsulfonyl)amino]-5-pyrimidinyl}-3,5-dihydroxy-6-heptenoic acid ; (3R,5S,6E)-7-{4-(4-Fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-(propan-2-yl)pyrimidin-5-yl}-3,5-dihydroxyhept-6-enoic acid |
| PubChem | 446157 |
| KEGG | D01915; D08492 |
| ChemSpider | 393589 |
| ChEBI | CHEBI:38545 |
| Wikipedia | Rosuvastatin |
| ChEMBL | CHEMBL1496 |
| HMDb | HMDB15230 |