Systematic / IUPAC Name: 3-[(2S,5aS,8aR)-1-Methyl-5-oxo-6-(thiadiazol-4-ylmethyl)-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-E][1,4]diazepin-2-yl]-N-phenylpropanamide
ID: Reference11222
Other Names: NAT23-391089
Formula: C20H26N6O2S
3-[(2S,5aS,8aR)-1-Methyl-5-oxo-6-(1,2,3-thiadiazol-4-ylmethyl)decahydropyrrolo[3,2-E][1,4]diazepin-2-yl]-N-phenylpropanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1575 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/18/2022 7:48:33 AM |
| InChI | InChI=1S/C20H26N6O2S/c1-25-16(7-8-18(27)22-14-5-3-2-4-6-14)11-21-20(28)19-17(25)9-10-26(19)12-15-13-29-24-23-15/h2-6,13,16-17,19H,7-12H2,1H3,(H,21,28)(H,22,27)/t16-,17+,19-/m0/s1 |
| InChI Key | ZNADEVJVXPGDJQ-SCTDSRPQSA-N |
| Canonical SMILES | CN1C2CCN(C2C(=O)NCC1CCC(=O)NC3=CC=CC=C3)CC4=CSN=N4 |
| CAS | |
| Splash | |
| Other Names | NAT23-391089 |