Systematic / IUPAC Name:
ID: Reference11230
Other Names: 11_CHL6
Formula: C18H15NO4
(2E)-3-(3,4-Dihydroxyphenyl)-1-(1-methoxy-1H-indol-3-yl)prop-2-en-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2251 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/11/2023 9:51:06 AM |
| InChI | InChI=1S/C18H15NO4/c1-23-19-11-13(14-4-2-3-5-15(14)19)7-8-16(20)12-6-9-17(21)18(22)10-12/h2-11,21-22H,1H3/b8-7+ |
| InChI Key | MQYCZGQPTRALPS-BQYQJAHWSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 11_CHL6 |