Systematic / IUPAC Name: N-[[(2R,4S,5R)-5-[5-(Furan-2-yl)-2-methylpyrazol-3-yl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]cyclohexanecarboxamide
ID: Reference11261
Other Names: NAT13-332923
Formula: C23H32N4O2
N-({(2R,4S,5R)-5-[3-(2-Furyl)-1-methyl-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)cyclohexanecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2165 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/4/2022 10:50:15 AM |
| InChI | InChI=1S/C23H32N4O2/c1-26-21(13-20(25-26)22-8-5-11-29-22)19-15-27-10-9-17(19)12-18(27)14-24-23(28)16-6-3-2-4-7-16/h5,8,11,13,16-19H,2-4,6-7,9-10,12,14-15H2,1H3,(H,24,28)/t17-,18+,19-/m0/s1 |
| InChI Key | OOMQJNUUWNSHSG-OTWHNJEPSA-N |
| Canonical SMILES | CN1C(=CC(=N1)C2=CC=CO2)C3CN4CCC3CC4CNC(=O)C5CCCCC5 |
| CAS | |
| Splash | |
| Other Names | NAT13-332923 |