Systematic / IUPAC Name: [(3S)-3-(5-Methyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]-phenylmethanone
ID: Reference11262
Other Names: NAT31-462515
Formula: C14H15N3O2
[(3S)-3-(5-Methyl-1,3,4-oxadiazol-2-yl)-1-pyrrolidinyl](phenyl)methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 395 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/4/2022 10:51:38 AM |
| InChI | InChI=1S/C14H15N3O2/c1-10-15-16-13(19-10)12-7-8-17(9-12)14(18)11-5-3-2-4-6-11/h2-6,12H,7-9H2,1H3/t12-/m0/s1 |
| InChI Key | BWBFVWLCNJZNCP-LBPRGKRZSA-N |
| Canonical SMILES | CC1=NN=C(O1)C2CCN(C2)C(=O)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT31-462515 |