Systematic / IUPAC Name: N-[4-[(2R,3R)-4-Benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-5-methyl-1,2-oxazole-3-carboxamide
ID: Reference11280
Other Names: NAT36-530884
Formula: C23H23N3O5
N-{4-[(2R,3R)-4-Benzyl-3-(hydroxymethyl)-5-oxo-2-morpholinyl]phenyl}-5-methyl-1,2-oxazole-3-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3317 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/11/2022 11:02:41 AM |
| InChI | InChI=1S/C23H23N3O5/c1-15-11-19(25-31-15)23(29)24-18-9-7-17(8-10-18)22-20(13-27)26(21(28)14-30-22)12-16-5-3-2-4-6-16/h2-11,20,22,27H,12-14H2,1H3,(H,24,29)/t20-,22-/m1/s1 |
| InChI Key | DXAJSACDHBOURQ-IFMALSPDSA-N |
| Canonical SMILES | CC1=CC(=NO1)C(=O)NC2=CC=C(C=C2)C3C(N(C(=O)CO3)CC4=CC=CC=C4)CO |
| CAS | |
| Splash | |
| Other Names | NAT36-530884 |