Systematic / IUPAC Name: (3R)-3-[5-(5-Chlorothiophen-2-yl)-1H-imidazol-2-yl]-4-cyclobutylmorpholine
ID: Reference11281
Other Names: NAT41-530334
Formula: C15H18ClN3OS
(3R)-3-[4-(5-Chloro-2-thienyl)-1H-imidazol-2-yl]-4-cyclobutylmorpholine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1160 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/11/2022 11:03:44 AM |
| InChI | InChI=1S/C15H18ClN3OS/c16-14-5-4-13(21-14)11-8-17-15(18-11)12-9-20-7-6-19(12)10-2-1-3-10/h4-5,8,10,12H,1-3,6-7,9H2,(H,17,18)/t12-/m0/s1 |
| InChI Key | WZNJANNVHIBUII-LBPRGKRZSA-N |
| Canonical SMILES | C1CC(C1)N2CCOCC2C3=NC=C(N3)C4=CC=C(S4)Cl |
| CAS | |
| Splash | |
| Other Names | NAT41-530334 |