Systematic / IUPAC Name: 4-Cyano-N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-(2-methylphenyl)cyclopentyl]benzamide
ID: Reference11283
Other Names: NAT38-539008
Formula: C20H20N2O3
4-Cyano-N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-(2-methylphenyl)cyclopentyl]benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1750 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/11/2022 11:08:24 AM |
| InChI | InChI=1S/C20H20N2O3/c1-12-4-2-3-5-15(12)16-10-17(23)19(24)18(16)22-20(25)14-8-6-13(11-21)7-9-14/h2-9,16-19,23-24H,10H2,1H3,(H,22,25)/t16-,17-,18-,19-/m1/s1 |
| InChI Key | KZUJRTUURXDRPK-NCXUSEDFSA-N |
| Canonical SMILES | CC1=CC=CC=C1C2CC(C(C2NC(=O)C3=CC=C(C=C3)C#N)O)O |
| CAS | |
| Splash | |
| Other Names | NAT38-539008 |