Systematic / IUPAC Name:
ID: Reference11284
Other Names: 30_CH10g
Formula: C21H20FNO2
(2E)-1-(4-Fluorophenyl)-3-[2-(2-methylpropoxy)-1H-indol-3-yl]prop-2-en-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 963 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/14/2022 1:52:37 PM |
| InChI | InChI=1S/C21H20FNO2/c1-14(2)13-25-21-18(17-5-3-4-6-19(17)23-21)11-12-20(24)15-7-9-16(22)10-8-15/h3-12,14,23H,13H2,1-2H3/b12-11+ |
| InChI Key | JEWKKGBTJZWETG-VAWYXSNFSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 30_CH10g |