Systematic / IUPAC Name:
ID: Reference11286
Other Names: 32_CHF3
Formula: C17H12FNO
(2E)-1-(4-Fluorophenyl)-3-(1H-indol-3-yl)prop-2-en-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1405 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/14/2022 1:59:31 PM |
| InChI | InChI=1S/C17H12FNO/c18-14-8-5-12(6-9-14)17(20)10-7-13-11-19-16-4-2-1-3-15(13)16/h1-11,19H/b10-7+ |
| InChI Key | WWPQCBWWSLFQME-JXMROGBWSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 32_CHF3 |