Systematic / IUPAC Name: N-[(1R,2S,3R,5R)-2,3-Dihydroxy-5-[6-(trifluoromethyl)pyridin-3-yl]cyclopentyl]-2-methoxyacetamide
ID: Reference11296
Other Names: NAT38-539281
Formula: C14H17F3N2O4
N-{(1R,2S,3R,5R)-2,3-Dihydroxy-5-[6-(trifluoromethyl)-3-pyridinyl]cyclopentyl}-2-methoxyacetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2420 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/18/2022 8:47:10 AM |
| InChI | InChI=1S/C14H17F3N2O4/c1-23-6-11(21)19-12-8(4-9(20)13(12)22)7-2-3-10(18-5-7)14(15,16)17/h2-3,5,8-9,12-13,20,22H,4,6H2,1H3,(H,19,21)/t8-,9-,12-,13-/m1/s1 |
| InChI Key | UUUCKBDOPZBZMM-NRMKKVEVSA-N |
| Canonical SMILES | COCC(=O)NC1C(CC(C1O)O)C2=CN=C(C=C2)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | NAT38-539281 |