Systematic / IUPAC Name:
ID: Reference11301
Other Names:
1-Methoxy-1H-indole-3-carboxylic acid;
87_MeOCOOH
Formula: C10H9NO3
1-Methoxyindole-3-carboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 895 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/24/2022 1:57:46 PM |
| InChI | InChI=1S/C10H9NO3/c1-14-11-6-8(10(12)13)7-4-2-3-5-9(7)11/h2-6H,1H3,(H,12,13) |
| InChI Key | NYXZLEZAQMDQPX-UHFFFAOYSA-N |
| Canonical SMILES | CON1C=C(C2=CC=CC=C21)C(=O)O |
| CAS | |
| Splash | |
| Other Names |
1-Methoxy-1H-indole-3-carboxylic acid; 87_MeOCOOH |