Systematic / IUPAC Name:
ID: Reference11330
Other Names: 40_PerHydrPh
Formula: C17H20N2O
N'-[(E)-[(4S)-4-(Prop-1-en-2-yl)cyclohex-1-en-1-yl]methylidene]benzohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 915 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/4/2022 10:43:34 AM |
| InChI | InChI=1S/C17H20N2O/c1-13(2)15-10-8-14(9-11-15)12-18-19-17(20)16-6-4-3-5-7-16/h3-8,12,15H,1,9-11H2,2H3,(H,19,20)/b18-12+/t15-/m1/s1 |
| InChI Key | MJKBPFFTSLVPSY-GYZOOYGHSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 40_PerHydrPh |