Systematic / IUPAC Name:
ID: Reference11332
Other Names: 42_PerHydrPh4F
Formula: C17H19FN2O
4-Fluoro-N'-[(E)-[(4S)-4-(prop-1-en-2-yl)cyclohex-1-en-1-yl]methylidene]benzohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1000 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/4/2022 11:16:12 AM |
| InChI | InChI=1S/C17H19FN2O/c1-12(2)14-5-3-13(4-6-14)11-19-20-17(21)15-7-9-16(18)10-8-15/h3,7-11,14H,1,4-6H2,2H3,(H,20,21)/b19-11+/t14-/m1/s1 |
| InChI Key | FHCQHFOCLBCXCY-HIPSJFSSSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 42_PerHydrPh4F |