Systematic / IUPAC Name:
ID: Reference11335
Other Names: 45_PerHydrPh4OMe
Formula: C18H22N2O2
4-Methoxy-N'-[(E)-[(4S)-4-(prop-1-en-2-yl)cyclohex-1-en-1-yl]methylidene]benzohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 700 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/4/2022 12:26:28 PM |
| InChI | InChI=1S/C18H22N2O2/c1-13(2)15-6-4-14(5-7-15)12-19-20-18(21)16-8-10-17(22-3)11-9-16/h4,8-12,15H,1,5-7H2,2-3H3,(H,20,21)/b19-12+/t15-/m1/s1 |
| InChI Key | VMAVRGMTEUEWPP-IYSPOMMRSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 45_PerHydrPh4OMe |