Systematic / IUPAC Name: N-[(E)-(6,6-Dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]benzamide
ID: Reference11345
Other Names: 47_MyrHydrPh
Formula: C17H20N2O
N'-[(E)-(6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl)methylene]benzohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 809 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/11/2022 10:30:34 AM |
| InChI | InChI=1S/C17H20N2O/c1-17(2)14-9-8-13(15(17)10-14)11-18-19-16(20)12-6-4-3-5-7-12/h3-8,11,14-15H,9-10H2,1-2H3,(H,19,20)/b18-11+ |
| InChI Key | MZVIKEGMFZGQKT-WOJGMQOQSA-N |
| Canonical SMILES | CC1(C2CC=C(C1C2)C=NNC(=O)C3=CC=CC=C3)C |
| CAS | |
| Splash | |
| Other Names | 47_MyrHydrPh |