Systematic / IUPAC Name: N-[(E)-(6,6-Dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methylideneamino]-2-fluorobenzamide
ID: Reference11346
Other Names: 48_MyrHydrPh2F
Formula: C17H19FN2O
N'-[(E)-(6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl)methylene]-2-fluorobenzohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1421 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/11/2022 10:33:33 AM |
| InChI | InChI=1S/C17H19FN2O/c1-17(2)12-8-7-11(14(17)9-12)10-19-20-16(21)13-5-3-4-6-15(13)18/h3-7,10,12,14H,8-9H2,1-2H3,(H,20,21)/b19-10+ |
| InChI Key | CCBXBQTVACSRLT-VXLYETTFSA-N |
| Canonical SMILES | CC1(C2CC=C(C1C2)C=NNC(=O)C3=CC=CC=C3F)C |
| CAS | |
| Splash | |
| Other Names | 48_MyrHydrPh2F |