Systematic / IUPAC Name: 4-Bromo-N'-[(E)-(6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl)methylidene]benzohydrazide
ID: Reference11349
Other Names: 51_MyrHydrPh4Br
Formula: C17H19BrN2O
N'-[(E)-{6,6-Dimethylbicyclo[3.1.1]hept-2-en-2-yl}methylidene]-4-bromobenzohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1536 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/11/2022 11:27:03 AM |
| InChI | InChI=1S/C17H19BrN2O/c1-17(2)13-6-3-12(15(17)9-13)10-19-20-16(21)11-4-7-14(18)8-5-11/h3-5,7-8,10,13,15H,6,9H2,1-2H3,(H,20,21)/b19-10+ |
| InChI Key | OJNAQVZULGQYTR-VXLYETTFSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 51_MyrHydrPh4Br |