Systematic / IUPAC Name: (E)-3-(1-Methylindol-3-yl)-1-phenylprop-2-en-1-one
ID: Reference11363
Other Names:
(2E)-3-(1-Methyl-1H-indol-3-yl)-1-phenylprop-2-en-1-one;
(E)-3-(1-Methyl-1H-indol-3-yl)-1-phenylprop-2-en-1-one;
91_iCHA
Formula: C18H15NO
(2E)-3-(1-Methyl-1H-indol-3-yl)-1-phenyl-2-propen-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 400 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/25/2022 11:46:56 AM |
| InChI | InChI=1S/C18H15NO/c1-19-13-15(16-9-5-6-10-17(16)19)11-12-18(20)14-7-3-2-4-8-14/h2-13H,1H3/b12-11+ |
| InChI Key | CILQBPPLINUZPV-VAWYXSNFSA-N |
| Canonical SMILES | CN1C=C(C2=CC=CC=C21)C=CC(=O)C3=CC=CC=C3 |
| CAS | 38470654 |
| Splash | |
| Other Names |
(2E)-3-(1-Methyl-1H-indol-3-yl)-1-phenylprop-2-en-1-one; (E)-3-(1-Methyl-1H-indol-3-yl)-1-phenylprop-2-en-1-one; 91_iCHA |
| PubChem | 5905206 |
| ChEMBL | CHEMBL1309946 |
| ChemSpider | 4741559 |