Systematic / IUPAC Name:
ID: Reference11368
Other Names: NAT47-553659
Formula: C13H17NO4
(6R)-4-(1,3-Benzodioxol-4-ylmethyl)-1,4-oxazepan-6-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 320 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/28/2022 11:44:52 AM |
| InChI | InChI=1S/C13H17NO4/c15-11-7-14(4-5-16-8-11)6-10-2-1-3-12-13(10)18-9-17-12/h1-3,11,15H,4-9H2/t11-/m1/s1 |
| InChI Key | VGMXWZFDCJZTIW-LLVKDONJSA-N |
| Canonical SMILES | C1COCC(CN1CC2=C3C(=CC=C2)OCO3)O |
| CAS | |
| Splash | |
| Other Names | NAT47-553659 |
| PubChem | 75536952 |
| ChEMBL | CHEMBL3437170 |
| ChemSpider | 29855635 |