Systematic / IUPAC Name:
ID: Reference11373
Other Names: 9-Acr-spiro-pyrol-Ph(4F)
Formula: C24H16FN5OS
1-(4-Fluorophenyl)-3-{4'-methyl-5'-oxo-1',5'-dihydro-10H-spiro[acridine-9,2'-pyrrol]-1'-yl}thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1515 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/2/2022 9:42:34 AM |
| InChI | InChI=1S/C24H16FN5OS/c25-16-9-11-17(12-10-16)27-23(32)29-30-22(31)15(14-26)13-24(30)18-5-1-3-7-20(18)28-21-8-4-2-6-19(21)24/h1-13,28H,(H2,27,29,32) |
| InChI Key | MUCMKCNQWSUXTD-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 9-Acr-spiro-pyrol-Ph(4F) |