Systematic / IUPAC Name:
ID: Reference11376
Other Names: 9-Acr-spiro-pyrol-Ph(3OMe)
Formula: C25H19N5O2S
1-(3-Methoxyphenyl)-3-{4'-methyl-5'-oxo-1',5'-dihydro-10H-spiro[acridine-9,2'-pyrrol]-1'-yl}thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1386 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/2/2022 10:48:00 AM |
| InChI | InChI=1S/C25H19N5O2S/c1-32-18-8-6-7-17(13-18)27-24(33)29-30-23(31)16(15-26)14-25(30)19-9-2-4-11-21(19)28-22-12-5-3-10-20(22)25/h2-14,28H,1H3,(H2,27,29,33) |
| InChI Key | DWWJLECUUPLTHB-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 9-Acr-spiro-pyrol-Ph(3OMe) |