Systematic / IUPAC Name:
ID: Reference11377
Other Names: 9-Acr-spiro-TZDMBA-Ph
Formula: C26H17N5O2S
4'-Methyl-1'-{[(2Z)-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]amino}-1',5'-dihydro-10H-spiro[acridine-9,2'-pyrrol]-5'-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1535 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/2/2022 10:53:02 AM |
| InChI | InChI=1S/C26H17N5O2S/c27-15-17-14-26(19-10-4-6-12-21(19)28-22-13-7-5-11-20(22)26)31(24(17)33)29-25-30(23(32)16-34-25)18-8-2-1-3-9-18/h1-14,28H,16H2/b29-25- |
| InChI Key | LFDHYEMAZJOTHP-GNVQSUKOSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 9-Acr-spiro-TZDMBA-Ph |