Systematic / IUPAC Name:
ID: Reference11379
Other Names: NAT47-552153
Formula: C14H19NO4
[(6R)-6-Methoxy-1,4-oxazepan-4-yl](3-methoxyphenyl)methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 865 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/5/2022 2:16:59 PM |
| InChI | InChI=1S/C14H19NO4/c1-17-12-5-3-4-11(8-12)14(16)15-6-7-19-10-13(9-15)18-2/h3-5,8,13H,6-7,9-10H2,1-2H3/t13-/m1/s1 |
| InChI Key | LKEHDLMGRGZRAK-CYBMUJFWSA-N |
| Canonical SMILES | COC1CN(CCOC1)C(=O)C2=CC(=CC=C2)OC |
| CAS | |
| Splash | |
| Other Names | NAT47-552153 |