Systematic / IUPAC Name: (6R)-4-(4-Methoxyphenyl)sulfonyl-6-pyrazin-2-yloxy-1,4-oxazepane
ID: Reference11383
Other Names: NAT47-552325
Formula: C16H19N3O5S
(6R)-4-[(4-Methoxyphenyl)sulfonyl]-6-(2-pyrazinyloxy)-1,4-oxazepane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1640 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/5/2022 2:29:42 PM |
| InChI | InChI=1S/C16H19N3O5S/c1-22-13-2-4-15(5-3-13)25(20,21)19-8-9-23-12-14(11-19)24-16-10-17-6-7-18-16/h2-7,10,14H,8-9,11-12H2,1H3/t14-/m1/s1 |
| InChI Key | IFRNCBNOASAYOU-CQSZACIVSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)S(=O)(=O)N2CCOCC(C2)OC3=NC=CN=C3 |
| CAS | |
| Splash | |
| Other Names | NAT47-552325 |
| ChemSpider | 29855497 |
| ChEMBL | CHEMBL3437307 |
| PubChem | 75536902 |