Systematic / IUPAC Name: (6R)-4-[(1-Methylimidazol-2-yl)methyl]-6-(4-methylsulfonylphenoxy)-1,4-oxazepane
ID: Reference11384
Other Names: NAT47-552481
Formula: C17H23N3O4S
(6R)-4-[(1-Methyl-1H-imidazol-2-yl)methyl]-6-[4-(methylsulfonyl)phenoxy]-1,4-oxazepane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 155 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/5/2022 2:31:19 PM |
| InChI | InChI=1S/C17H23N3O4S/c1-19-8-7-18-17(19)12-20-9-10-23-13-15(11-20)24-14-3-5-16(6-4-14)25(2,21)22/h3-8,15H,9-13H2,1-2H3/t15-/m1/s1 |
| InChI Key | NIYFGACWKUSGCT-OAHLLOKOSA-N |
| Canonical SMILES | CN1C=CN=C1CN2CCOCC(C2)OC3=CC=C(C=C3)S(=O)(=O)C |
| CAS | |
| Splash | |
| Other Names | NAT47-552481 |