Systematic / IUPAC Name:
ID: Reference11404
Other Names: 9-Acr-spiro-TZDDEAD-Ph(3OMe)
Formula: C31H23N5O5S
Ethyl 2-[(2Z,5Z)-3-(3-methoxyphenyl)-2-({4'-methyl-5'-oxo-1',5'-dihydro-10H-spiro[acridine-9,2'-pyrrol]-1'-yl}imino)-4-oxo-1,3-thiazolidin-5-ylidene]acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1952 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/25/2022 8:27:51 AM |
| InChI | InChI=1S/C31H23N5O5S/c1-3-41-27(37)16-26-29(39)35(20-9-8-10-21(15-20)40-2)30(42-26)34-36-28(38)19(18-32)17-31(36)22-11-4-6-13-24(22)33-25-14-7-5-12-23(25)31/h4-17,33H,3H2,1-2H3/b26-16-,34-30- |
| InChI Key | QVCGKMUNQYNYOC-WFFIEQMCSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 9-Acr-spiro-TZDDEAD-Ph(3OMe) |