Systematic / IUPAC Name: 2-[1-[2-[[(1S,2R,3R,5S)-5-[[(2S)-1-Amino-1-oxo-3-thiophen-2-ylpropan-2-yl]carbamoyl]-2,3,5-trihydroxycyclohexyl]amino]-2-oxoethyl]cyclopentyl]acetic acid
ID: Reference11409
Other Names: NAT2-252534
Formula: C23H33N3O8S
[1-(2-{[(1S,2R,3R,5S)-5-{[(2S)-1-Amino-1-oxo-3-(2-thienyl)-2-propanyl]carbamoyl}-2,3,5-trihydroxycyclohexyl]amino}-2-oxoethyl)cyclopentyl]acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2713 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/25/2022 8:49:24 AM |
| InChI | InChI=1S/C23H33N3O8S/c24-20(32)14(8-13-4-3-7-35-13)26-21(33)23(34)9-15(19(31)16(27)10-23)25-17(28)11-22(12-18(29)30)5-1-2-6-22/h3-4,7,14-16,19,27,31,34H,1-2,5-6,8-12H2,(H2,24,32)(H,25,28)(H,26,33)(H,29,30)/t14-,15-,16+,19+,23-/m0/s1 |
| InChI Key | CXHYZRIOBBEZRA-HCLAZUBHSA-N |
| Canonical SMILES | C1CCC(C1)(CC(=O)NC2CC(CC(C2O)O)(C(=O)NC(CC3=CC=CS3)C(=O)N)O)CC(=O)O |
| CAS | |
| Splash | |
| Other Names | NAT2-252534 |