Systematic / IUPAC Name: (8aR)-7-[(6-Methoxypyridin-2-yl)methyl]-2-methyl-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-one
ID: Reference11448
Other Names: NAT50-557230
Formula: C14H20N4O2
(8aR)-7-[(6-Methoxy-2-pyridinyl)methyl]-2-methylhexahydroimidazo[1,5-a]pyrazin-3(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 945 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/6/2022 10:55:36 AM |
| InChI | InChI=1S/C14H20N4O2/c1-16-9-12-10-17(6-7-18(12)14(16)19)8-11-4-3-5-13(15-11)20-2/h3-5,12H,6-10H2,1-2H3/t12-/m0/s1 |
| InChI Key | VXRWBPLUPMWYQO-LBPRGKRZSA-N |
| Canonical SMILES | CN1CC2CN(CCN2C1=O)CC3=NC(=CC=C3)OC |
| CAS | |
| Splash | |
| Other Names | NAT50-557230 |