Systematic / IUPAC Name: Butyl 2-(4-{[5-(trifluoromethyl)-2-pyridinyl]oxy}phenoxy)propanoate
ID: Reference1145
Other Names:
Fusilade;
Halokon;
Onecide EC;
Onecide;
2-(4-{[5-(Trifluoromethyl)-2-pyridinyl]oxy}phenoxy)propanoic acid butyl ester
; more
Formula: C19H20F3NO4
Class: Pesticides/Herbicides
Fluazifop-butyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 7 |
| No. of Spectra | 1481 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 2/18/2025 2:41:22 PM |
| InChI | InChI=1S/C19H20F3NO4/c1-3-4-11-25-18(24)13(2)26-15-6-8-16(9-7-15)27-17-10-5-14(12-23-17)19(20,21)22/h5-10,12-13H,3-4,11H2,1-2H3 |
| InChI Key | VAIZTNZGPYBOGF-UHFFFAOYSA-N |
| Canonical SMILES | CCCCOC(=O)C(C)OC1=CC=C(C=C1)OC2=NC=C(C=C2)C(F)(F)F |
| CAS | 69806504 |
| Splash | |
| Other Names |
Fusilade; Halokon; Onecide EC; Onecide; 2-(4-{[5-(Trifluoromethyl)-2-pyridinyl]oxy}phenoxy)propanoic acid butyl ester ; Fluazifop-P-butyl; Propanoic acid, 2-(4-{[5-(trifluoromethyl)-2-pyridinyl]oxy}phenoxy)-, butyl ester ; Propionic acid, 2-(p-{[5-(trifluoromethyl)-2-pyridyl]oxy}phenoxy), butyl ester |
| KEGG | C11029 |
| ChEMBL | CHEMBL449397 |
| Wikipedia | Fluazifop-P-butyl (DE) |
| ChemIDPlus | 069806504; 086334147 |
| ChemSpider | 46142 |
| PubChem | 50897 |