Systematic / IUPAC Name: (2S)-2-[(1S,4aS,7S,8S,8aS)-1-Hydroxy-4a,8-dimethyl-7-[(2-phenylacetyl)amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-(2-morpholin-4-ylethyl)propanamide
ID: Reference11463
Other Names: NAT5-397308
Formula: C29H45N3O4
(2S)-2-{(1S,7S,8S,8aS)-1-Hydroxy-4a,8-dimethyl-7-[(phenylacetyl)amino]decahydro-2-naphthalenyl}-N-[2-(4-morpholinyl)ethyl]propanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2870 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/15/2022 2:14:54 PM |
| InChI | InChI=1S/C29H45N3O4/c1-20(28(35)30-13-14-32-15-17-36-18-16-32)23-9-11-29(3)12-10-24(21(2)26(29)27(23)34)31-25(33)19-22-7-5-4-6-8-22/h4-8,20-21,23-24,26-27,34H,9-19H2,1-3H3,(H,30,35)(H,31,33)/t20-,21+,23?,24-,26+,27-,29-/m0/s1 |
| InChI Key | HUXLCPYMVXFVOH-SDYKJARBSA-N |
| Canonical SMILES | CC1C(CCC2(C1C(C(CC2)C(C)C(=O)NCCN3CCOCC3)O)C)NC(=O)CC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT5-397308 |