Systematic / IUPAC Name: N-[(1S,2S,4aS,8S,8aS)-8-Hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-3-methoxypropanamide
ID: Reference11471
Other Names: NAT5-397809
Formula: C24H42N2O4
N-{(1S,2S,8S,8aS)-8-Hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-(1-piperidinyl)-2-propanyl]decahydro-2-naphthalenyl}-3-methoxypropanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1545 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/23/2022 11:18:25 AM |
| InChI | InChI=1S/C24H42N2O4/c1-16(23(29)26-13-6-5-7-14-26)18-8-11-24(3)12-9-19(17(2)21(24)22(18)28)25-20(27)10-15-30-4/h16-19,21-22,28H,5-15H2,1-4H3,(H,25,27)/t16-,17+,18?,19-,21+,22-,24-/m0/s1 |
| InChI Key | FJSCLNFECOUEBO-CCYSFVQSSA-N |
| Canonical SMILES | CC1C(CCC2(C1C(C(CC2)C(C)C(=O)N3CCCCC3)O)C)NC(=O)CCOC |
| CAS | |
| Splash | |
| Other Names | NAT5-397809 |