Systematic / IUPAC Name: [(2R,4S,5S)-5-Ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl N-(3,5-dimethoxyphenyl)carbamate
ID: Reference11488
Other Names: NAT13-337340
Formula: C19H24N2O4
[(2R,4S,5S)-5-Ethynyl-1-azabicyclo[2.2.2]oct-2-yl]methyl (3,5-dimethoxyphenyl)carbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1638 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/23/2022 8:18:22 AM |
| InChI | InChI=1S/C19H24N2O4/c1-4-13-11-21-6-5-14(13)7-16(21)12-25-19(22)20-15-8-17(23-2)10-18(9-15)24-3/h1,8-10,13-14,16H,5-7,11-12H2,2-3H3,(H,20,22)/t13-,14-,16+/m0/s1 |
| InChI Key | YVEFWOUVVOXWEH-OFQRWUPVSA-N |
| Canonical SMILES | COC1=CC(=CC(=C1)NC(=O)OCC2CC3CCN2CC3C#C)OC |
| CAS | |
| Splash | |
| Other Names | NAT13-337340 |