Systematic / IUPAC Name: N-[[(2R,4S,5R)-5-[5-(Furan-2-yl)-2-methylpyrazol-3-yl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]morpholine-4-carboxamide
ID: Reference11489
Other Names: NAT13-332910
Formula: C21H29N5O3
N-({(2R,4S,5R)-5-[3-(2-Furyl)-1-methyl-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)-4-morpholinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 790 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/23/2022 8:20:49 AM |
| InChI | InChI=1S/C21H29N5O3/c1-24-19(12-18(23-24)20-3-2-8-29-20)17-14-26-5-4-15(17)11-16(26)13-22-21(27)25-6-9-28-10-7-25/h2-3,8,12,15-17H,4-7,9-11,13-14H2,1H3,(H,22,27)/t15-,16+,17-/m0/s1 |
| InChI Key | ORMTXVHNDAKOKY-BBWFWOEESA-N |
| Canonical SMILES | CN1C(=CC(=N1)C2=CC=CO2)C3CN4CCC3CC4CNC(=O)N5CCOCC5 |
| CAS | |
| Splash | |
| Other Names | NAT13-332910 |