Systematic / IUPAC Name: N-[(6aS,7S)-2-(4-Methylsulfanylphenyl)-6,11-dioxo-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-7-yl]cyclopentanecarboxamide
ID: Reference11490
Other Names: NAT3-328015
Formula: C25H27N3O3S
N-{(1S,11aS)-7-[4-(Methylsulfanyl)phenyl]-5,11-dioxo-2,3,5,10,11,11a-hexahydro-1H-pyrrolo[2,1-c][1,4]benzodiazepin-1-yl}cyclopentanecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1420 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/23/2022 8:24:20 AM |
| InChI | InChI=1S/C25H27N3O3S/c1-32-18-9-6-15(7-10-18)17-8-11-20-19(14-17)25(31)28-13-12-21(22(28)24(30)26-20)27-23(29)16-4-2-3-5-16/h6-11,14,16,21-22H,2-5,12-13H2,1H3,(H,26,30)(H,27,29)/t21-,22-/m0/s1 |
| InChI Key | BBMPCINCJNWVIY-VXKWHMMOSA-N |
| Canonical SMILES | CSC1=CC=C(C=C1)C2=CC3=C(C=C2)NC(=O)C4C(CCN4C3=O)NC(=O)C5CCCC5 |
| CAS | |
| Splash | |
| Other Names | NAT3-328015 |