Systematic / IUPAC Name: (6R)-4-[(6-Methoxypyridin-3-yl)methyl]-1,4-oxazepan-6-ol
ID: Reference11498
Other Names: NAT47-553677
Formula: C12H18N2O3
(6R)-4-[(6-Methoxy-3-pyridinyl)methyl]-1,4-oxazepan-6-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 314 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/23/2022 2:20:38 PM |
| InChI | InChI=1S/C12H18N2O3/c1-16-12-3-2-10(6-13-12)7-14-4-5-17-9-11(15)8-14/h2-3,6,11,15H,4-5,7-9H2,1H3/t11-/m1/s1 |
| InChI Key | HNPJWTXFNGVESX-LLVKDONJSA-N |
| Canonical SMILES | COC1=NC=C(C=C1)CN2CCOCC(C2)O |
| CAS | |
| Splash | |
| Other Names | NAT47-553677 |