Systematic / IUPAC Name: 3-(6-Cyclohexyloxypyridin-3-yl)-5-[(2S)-1-(2-methylpropyl)pyrrolidin-2-yl]-1,2,4-oxadiazole
ID: Reference11520
Other Names: NAT18-432702
Formula: C21H30N4O2
2-(Cyclohexyloxy)-5-{5-[(2S)-1-isobutyl-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 305 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/28/2022 10:13:25 AM |
| InChI | InChI=1S/C21H30N4O2/c1-15(2)14-25-12-6-9-18(25)21-23-20(24-27-21)16-10-11-19(22-13-16)26-17-7-4-3-5-8-17/h10-11,13,15,17-18H,3-9,12,14H2,1-2H3/t18-/m0/s1 |
| InChI Key | ASPNREICVDRVDX-SFHVURJKSA-N |
| Canonical SMILES | CC(C)CN1CCCC1C2=NC(=NO2)C3=CN=C(C=C3)OC4CCCCC4 |
| CAS | |
| Splash | |
| Other Names | NAT18-432702 |