Systematic / IUPAC Name: N-[[(1S,4S,6S)-3-Methyl-4-[2-[methyl(pyridin-3-ylmethyl)amino]-2-oxoethyl]-6-propan-2-ylcyclohex-2-en-1-yl]methyl]pyrazine-2-carboxamide
ID: Reference11532
Other Names: NAT28-408107
Formula: C25H33N5O2
N-{[(1S,4S,6S)-6-Isopropyl-3-methyl-4-{2-[methyl(3-pyridinylmethyl)amino]-2-oxoethyl}-2-cyclohexen-1-yl]methyl}-2-pyrazinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2907 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/6/2022 1:20:31 PM |
| InChI | InChI=1S/C25H33N5O2/c1-17(2)22-11-20(12-24(31)30(4)16-19-6-5-7-26-13-19)18(3)10-21(22)14-29-25(32)23-15-27-8-9-28-23/h5-10,13,15,17,20-22H,11-12,14,16H2,1-4H3,(H,29,32)/t20-,21-,22-/m0/s1 |
| InChI Key | DDTICKDNZRCSTR-FKBYEOEOSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC(=O)N(C)CC2=CN=CC=C2)C(C)C)CNC(=O)C3=NC=CN=C3 |
| CAS | |
| Splash | |
| Other Names | NAT28-408107 |