Systematic / IUPAC Name: N-[(2-Methoxyphenyl)methyl]-1-[(1S,4S,6S)-3-methyl-6-propan-2-yl-4-[(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)methyl]cyclohex-2-en-1-yl]methanamine
ID: Reference11538
Other Names: NAT28-411366
Formula: C27H34N4O2
1-[(1S,4S,6S)-6-Isopropyl-3-methyl-4-{[5-(3-pyridinyl)-1,3,4-oxadiazol-2-yl]methyl}-2-cyclohexen-1-yl]-N-(2-methoxybenzyl)methanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1565 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/7/2022 7:24:52 AM |
| InChI | InChI=1S/C27H34N4O2/c1-18(2)24-13-22(14-26-30-31-27(33-26)21-9-7-11-28-16-21)19(3)12-23(24)17-29-15-20-8-5-6-10-25(20)32-4/h5-12,16,18,22-24,29H,13-15,17H2,1-4H3/t22-,23-,24-/m0/s1 |
| InChI Key | FBTLNUZJRAUXNC-HJOGWXRNSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NN=C(O2)C3=CN=CC=C3)C(C)C)CNCC4=CC=CC=C4OC |
| CAS | |
| Splash | |
| Other Names | NAT28-411366 |