Systematic / IUPAC Name: 1-[(1S,4S,6S)-3-Methyl-4-[[5-(3-methylimidazol-4-yl)-1,3,4-oxadiazol-2-yl]methyl]-6-propan-2-ylcyclohex-2-en-1-yl]-N-(pyridin-4-ylmethyl)methanamine
ID: Reference11539
Other Names: NAT28-414409
Formula: C24H32N6O
1-[(1S,4S,6S)-6-Isopropyl-3-methyl-4-{[5-(1-methyl-1H-imidazol-5-yl)-1,3,4-oxadiazol-2-yl]methyl}-2-cyclohexen-1-yl]-N-(4-pyridinylmethyl)methanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1460 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/7/2022 7:27:38 AM |
| InChI | InChI=1S/C24H32N6O/c1-16(2)21-10-19(11-23-28-29-24(31-23)22-14-27-15-30(22)4)17(3)9-20(21)13-26-12-18-5-7-25-8-6-18/h5-9,14-16,19-21,26H,10-13H2,1-4H3/t19-,20-,21-/m0/s1 |
| InChI Key | GDWVHMPNQJUWLQ-ACRUOGEOSA-N |
| Canonical SMILES | CC1=CC(C(CC1CC2=NN=C(O2)C3=CN=CN3C)C(C)C)CNCC4=CC=NC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT28-414409 |