Systematic / IUPAC Name: 3-(6-Cyclohexyloxypyridin-3-yl)-5-[(2S)-1-[(4-methoxyphenyl)methyl]pyrrolidin-2-yl]-1,2,4-oxadiazole
ID: Reference11551
Other Names: NAT18-432682
Formula: C25H30N4O3
2-(Cyclohexyloxy)-5-{5-[(2S)-1-(4-methoxybenzyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1168 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/12/2022 7:36:30 AM |
| InChI | InChI=1S/C25H30N4O3/c1-30-20-12-9-18(10-13-20)17-29-15-5-8-22(29)25-27-24(28-32-25)19-11-14-23(26-16-19)31-21-6-3-2-4-7-21/h9-14,16,21-22H,2-8,15,17H2,1H3/t22-/m0/s1 |
| InChI Key | VYICQULNUABHSB-QFIPXVFZSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)CN2CCCC2C3=NC(=NO3)C4=CN=C(C=C4)OC5CCCCC5 |
| CAS | |
| Splash | |
| Other Names | NAT18-432682 |