Systematic / IUPAC Name: 5-[(2S)-1-(Furan-2-ylmethyl)pyrrolidin-2-yl]-3-[2-(2-methoxyethoxy)pyridin-3-yl]-1,2,4-oxadiazole
ID: Reference11553
Other Names: NAT18-430247
Formula: C19H22N4O4
3-{5-[(2S)-1-(2-Furylmethyl)-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-(2-methoxyethoxy)pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 310 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/12/2022 7:40:41 AM |
| InChI | InChI=1S/C19H22N4O4/c1-24-11-12-26-18-15(6-2-8-20-18)17-21-19(27-22-17)16-7-3-9-23(16)13-14-5-4-10-25-14/h2,4-6,8,10,16H,3,7,9,11-13H2,1H3/t16-/m0/s1 |
| InChI Key | SGOLIFYWXMODOM-INIZCTEOSA-N |
| Canonical SMILES | COCCOC1=C(C=CC=N1)C2=NOC(=N2)C3CCCN3CC4=CC=CO4 |
| CAS | |
| Splash | |
| Other Names | NAT18-430247 |