Systematic / IUPAC Name: 1-{(2Z)-3-[(6-Chloro-3-pyridinyl)methyl]-1,3-thiazolidin-2-ylidene}urea
ID: Reference1156
Other Names: [3-(6-Chloro-3-pyridylmethyl)thiazolidin-2-ylidene]urea
Formula: C10H11ClN4OS
Class: Pesticides/Herbicides
Thiacloprid-amide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 1 |
| No. of Spectra | 53 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/5/2014 9:25:32 AM |
| InChI | InChI=1S/C10H11ClN4OS/c11-8-2-1-7(5-13-8)6-15-3-4-17-10(15)14-9(12)16/h1-2,5H,3-4,6H2,(H2,12,16)/b14-10- |
| InChI Key | LEZHOZPJYAQQNU-UVTDQMKNSA-N |
| Canonical SMILES | Clc1ncc(cc1)CN2C(=N/C(=O)N)/SCC2 |
| CAS | 676228914 |
| Splash | |
| Other Names | [3-(6-Chloro-3-pyridylmethyl)thiazolidin-2-ylidene]urea |