Systematic / IUPAC Name: N-[4-[(R)-Hydroxy-[(3R)-4-methyl-5-oxomorpholin-3-yl]methyl]phenyl]-2-methoxyacetamide
ID: Reference11582
Other Names: NAT36-509533
Formula: C15H20N2O5
N-(4-{(R)-Hydroxy[(3R)-4-methyl-5-oxo-3-morpholinyl]methyl}phenyl)-2-methoxyacetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1360 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/19/2022 3:22:29 PM |
| InChI | InChI=1S/C15H20N2O5/c1-17-12(7-22-9-14(17)19)15(20)10-3-5-11(6-4-10)16-13(18)8-21-2/h3-6,12,15,20H,7-9H2,1-2H3,(H,16,18)/t12-,15-/m1/s1 |
| InChI Key | VQXNVKOZTXAZRC-IUODEOHRSA-N |
| Canonical SMILES | CN1C(COCC1=O)C(C2=CC=C(C=C2)NC(=O)COC)O |
| CAS | |
| Splash | |
| Other Names | NAT36-509533 |
| PubChem | 56774893 |
| ChemSpider | 29851559 |
| ChEMBL | CHEMBL3437258 |