Systematic / IUPAC Name: (6R)-4-[(5-Methylfuran-2-yl)methyl]-6-phenoxy-1,4-oxazepane
ID: Reference11624
Other Names: NAT47-552424
Formula: C17H21NO3
(6R)-4-[(5-Methyl-2-furyl)methyl]-6-phenoxy-1,4-oxazepane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 520 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/2/2022 8:19:54 AM |
| InChI | InChI=1S/C17H21NO3/c1-14-7-8-16(20-14)11-18-9-10-19-13-17(12-18)21-15-5-3-2-4-6-15/h2-8,17H,9-13H2,1H3/t17-/m1/s1 |
| InChI Key | NFSXTTZNFZOMQA-QGZVFWFLSA-N |
| Canonical SMILES | CC1=CC=C(O1)CN2CCOCC(C2)OC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT47-552424 |